C26H38ClN3O5 — CID 69078029
2-[3-[4-(2-cyclopentyloxyphenyl)piperazin-1-yl]propyl]-4,7-dihydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione;hydrochloride (PubChem CID 69078029) has the molecular formula C26H38ClN3O5 and a molecular weight of 508.06 g/mol. Its IUPAC name is 2-[3-[4-(2-cyclopentyloxyphenyl)piperazin-1-yl]propyl]-4,7-dihydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione;hydrochloride.
| Compound Name | 2-[3-[4-(2-cyclopentyloxyphenyl)piperazin-1-yl]propyl]-4,7-dihydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 69078029 |
| Molecular Formula | C26H38ClN3O5 |
| Molecular Weight | 508.06 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | 2-[3-[4-(2-cyclopentyloxyphenyl)piperazin-1-yl]propyl]-4,7-dihydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione;hydrochloride |
| SMILES | Cl.O=C1C2C(O)CCC(O)C2C(=O)N1CCCN1CCN(c2ccccc2OC2CCCC2)CC1 |
| InChI | InChI=1S/C26H37N3O5.ClH/c30-20-10-11-21(31)24-23(20)25(32)29(26(24)33)13-5-12-27-14-16-28(17-15-27)19-8-3-4-9-22(19)34-18-6-1-2-7-18;/h3-4,8-9,18,20-21,23-24,30-31H,1-2,5-7,10-17H2;1H |
| InChIKey | YMYAXTSTOCRNDX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.06 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|