C26H40N4O3 — CID 69432939
3-(1-amino-2-methylpropyl)-1-[3-[4-(2-cyclopentyloxyphenyl)piperazin-1-yl]propyl]pyrrolidine-2,5-dione (PubChem CID 69432939) has the molecular formula C26H40N4O3 and a molecular weight of 456.63 g/mol. Its IUPAC name is 3-(1-amino-2-methylpropyl)-1-[3-[4-(2-cyclopentyloxyphenyl)piperazin-1-yl]propyl]pyrrolidine-2,5-dione.
| Compound Name | 3-(1-amino-2-methylpropyl)-1-[3-[4-(2-cyclopentyloxyphenyl)piperazin-1-yl]propyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 69432939 |
| Molecular Formula | C26H40N4O3 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | 3-(1-amino-2-methylpropyl)-1-[3-[4-(2-cyclopentyloxyphenyl)piperazin-1-yl]propyl]pyrrolidine-2,5-dione |
| SMILES | CC(C)C(N)C1CC(=O)N(CCCN2CCN(c3ccccc3OC3CCCC3)CC2)C1=O |
| InChI | InChI=1S/C26H40N4O3/c1-19(2)25(27)21-18-24(31)30(26(21)32)13-7-12-28-14-16-29(17-15-28)22-10-5-6-11-23(22)33-20-8-3-4-9-20/h5-6,10-11,19-21,25H,3-4,7-9,12-18,27H2,1-2H3 |
| InChIKey | OQNODXLQVYNJII-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|