C24H34ClN3O3 — CID 69440985
1-[3-[4-(2-cyclopentyloxyphenyl)piperazin-1-yl]propyl]-3,4-dimethylpyrrole-2,5-dione;hydrochloride (PubChem CID 69440985) has the molecular formula C24H34ClN3O3 and a molecular weight of 448.01 g/mol. Its IUPAC name is 1-[3-[4-(2-cyclopentyloxyphenyl)piperazin-1-yl]propyl]-3,4-dimethylpyrrole-2,5-dione;hydrochloride.
| Compound Name | 1-[3-[4-(2-cyclopentyloxyphenyl)piperazin-1-yl]propyl]-3,4-dimethylpyrrole-2,5-dione;hydrochloride |
|---|---|
| PubChem CID | 69440985 |
| Molecular Formula | C24H34ClN3O3 |
| Molecular Weight | 448.01 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 1-[3-[4-(2-cyclopentyloxyphenyl)piperazin-1-yl]propyl]-3,4-dimethylpyrrole-2,5-dione;hydrochloride |
| SMILES | CC1=C(C)C(=O)N(CCCN2CCN(c3ccccc3OC3CCCC3)CC2)C1=O.Cl |
| InChI | InChI=1S/C24H33N3O3.ClH/c1-18-19(2)24(29)27(23(18)28)13-7-12-25-14-16-26(17-15-25)21-10-5-6-11-22(21)30-20-8-3-4-9-20;/h5-6,10-11,20H,3-4,7-9,12-17H2,1-2H3;1H |
| InChIKey | JIGDWTFOFYWPTP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.01 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|