C30H39N3O7 — CID 11555810
[7-acetyloxy-2-[3-[4-(2-cyclopentyloxyphenyl)piperazin-1-yl]propyl]-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl] acetate (PubChem CID 11555810) has the molecular formula C30H39N3O7 and a molecular weight of 553.66 g/mol. Its IUPAC name is [7-acetyloxy-2-[3-[4-(2-cyclopentyloxyphenyl)piperazin-1-yl]propyl]-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl] acetate.
| Compound Name | [7-acetyloxy-2-[3-[4-(2-cyclopentyloxyphenyl)piperazin-1-yl]propyl]-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl] acetate |
|---|---|
| PubChem CID | 11555810 |
| Molecular Formula | C30H39N3O7 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | [7-acetyloxy-2-[3-[4-(2-cyclopentyloxyphenyl)piperazin-1-yl]propyl]-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl] acetate |
| SMILES | CC(=O)OC1C=CC(OC(C)=O)C2C(=O)N(CCCN3CCN(c4ccccc4OC4CCCC4)CC3)C(=O)C12 |
| InChI | InChI=1S/C30H39N3O7/c1-20(34)38-25-12-13-26(39-21(2)35)28-27(25)29(36)33(30(28)37)15-7-14-31-16-18-32(19-17-31)23-10-5-6-11-24(23)40-22-8-3-4-9-22/h5-6,10-13,22,25-28H,3-4,7-9,14-19H2,1-2H3 |
| InChIKey | JJCOHSLQRZQXOB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 105.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|