C20H34ClN3O3 — CID 141019598
1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]piperidine-2,6-diol;hydrochloride (PubChem CID 141019598) has the molecular formula C20H34ClN3O3 and a molecular weight of 399.96 g/mol. Its IUPAC name is 1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]piperidine-2,6-diol;hydrochloride.
| Compound Name | 1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]piperidine-2,6-diol;hydrochloride |
|---|---|
| PubChem CID | 141019598 |
| Molecular Formula | C20H34ClN3O3 |
| Molecular Weight | 399.96 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]piperidine-2,6-diol;hydrochloride |
| SMILES | COc1ccccc1N1CCN(CCCCN2C(O)CCCC2O)CC1.Cl |
| InChI | InChI=1S/C20H33N3O3.ClH/c1-26-18-8-3-2-7-17(18)22-15-13-21(14-16-22)11-4-5-12-23-19(24)9-6-10-20(23)25;/h2-3,7-8,19-20,24-25H,4-6,9-16H2,1H3;1H |
| InChIKey | GLRRBEDIMHGVBK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 59.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.96 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|