C23H37N3O2 — CID 139835093
N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-N-methylcyclohexanecarboxamide (PubChem CID 139835093) has the molecular formula C23H37N3O2 and a molecular weight of 387.57 g/mol. Its IUPAC name is N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-N-methylcyclohexanecarboxamide.
| Compound Name | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-N-methylcyclohexanecarboxamide |
|---|---|
| PubChem CID | 139835093 |
| Molecular Formula | C23H37N3O2 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.29 |
| IUPAC Name | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-N-methylcyclohexanecarboxamide |
| SMILES | COc1ccccc1N1CCN(CCCCN(C)C(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C23H37N3O2/c1-24(23(27)20-10-4-3-5-11-20)14-8-9-15-25-16-18-26(19-17-25)21-12-6-7-13-22(21)28-2/h6-7,12-13,20H,3-5,8-11,14-19H2,1-2H3 |
| InChIKey | PDAGBKSBWOIDMU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|