C26H34N4O4 — CID 22458136
N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-N-(4-nitrophenyl)cyclohexanecarboxamide (PubChem CID 22458136) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-N-(4-nitrophenyl)cyclohexanecarboxamide.
| Compound Name | N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-N-(4-nitrophenyl)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 22458136 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-N-(4-nitrophenyl)cyclohexanecarboxamide |
| SMILES | COc1ccccc1N1CCN(CCN(C(=O)C2CCCCC2)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C26H34N4O4/c1-34-25-10-6-5-9-24(25)28-18-15-27(16-19-28)17-20-29(26(31)21-7-3-2-4-8-21)22-11-13-23(14-12-22)30(32)33/h5-6,9-14,21H,2-4,7-8,15-20H2,1H3 |
| InChIKey | DKHWWNTVIMCSTD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 79.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|