C28H36F3N3O4 — CID 70145702
N-[2-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]ethyl]-N-[2-(trifluoromethoxy)phenyl]cyclohexanecarboxamide (PubChem CID 70145702) has the molecular formula C28H36F3N3O4 and a molecular weight of 535.61 g/mol. Its IUPAC name is N-[2-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]ethyl]-N-[2-(trifluoromethoxy)phenyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]ethyl]-N-[2-(trifluoromethoxy)phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 70145702 |
| Molecular Formula | C28H36F3N3O4 |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | N-[2-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]ethyl]-N-[2-(trifluoromethoxy)phenyl]cyclohexanecarboxamide |
| SMILES | COc1ccc(N2CCN(CCN(C(=O)C3CCCCC3)c3ccccc3OC(F)(F)F)CC2)c(OC)c1 |
| InChI | InChI=1S/C28H36F3N3O4/c1-36-22-12-13-23(26(20-22)37-2)33-17-14-32(15-18-33)16-19-34(27(35)21-8-4-3-5-9-21)24-10-6-7-11-25(24)38-28(29,30)31/h6-7,10-13,20-21H,3-5,8-9,14-19H2,1-2H3 |
| InChIKey | YFBYULZRTUQNKF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 54.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|