C29H41N5O3 — CID 70238622
N-[2-[4-[4-(butanoylamino)-2-methoxyphenyl]piperazin-1-yl]ethyl]-N-pyridin-2-ylcyclohexanecarboxamide (PubChem CID 70238622) has the molecular formula C29H41N5O3 and a molecular weight of 507.68 g/mol. Its IUPAC name is N-[2-[4-[4-(butanoylamino)-2-methoxyphenyl]piperazin-1-yl]ethyl]-N-pyridin-2-ylcyclohexanecarboxamide.
| Compound Name | N-[2-[4-[4-(butanoylamino)-2-methoxyphenyl]piperazin-1-yl]ethyl]-N-pyridin-2-ylcyclohexanecarboxamide |
|---|---|
| PubChem CID | 70238622 |
| Molecular Formula | C29H41N5O3 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.32 |
| IUPAC Name | N-[2-[4-[4-(butanoylamino)-2-methoxyphenyl]piperazin-1-yl]ethyl]-N-pyridin-2-ylcyclohexanecarboxamide |
| SMILES | CCCC(=O)Nc1ccc(N2CCN(CCN(C(=O)C3CCCCC3)c3ccccn3)CC2)c(OC)c1 |
| InChI | InChI=1S/C29H41N5O3/c1-3-9-28(35)31-24-13-14-25(26(22-24)37-2)33-19-16-32(17-20-33)18-21-34(27-12-7-8-15-30-27)29(36)23-10-5-4-6-11-23/h7-8,12-15,22-23H,3-6,9-11,16-21H2,1-2H3,(H,31,35) |
| InChIKey | SMODQVQFMFUFSX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|