C25H34N4O2 — CID 71752990
1,2,2,3,3,4,4,5,5,6,6-undecadeuterio-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-N-pyridin-2-ylcyclohexane-1-carboxamide (PubChem CID 71752990) has the molecular formula C25H34N4O2 and a molecular weight of 433.64 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6-undecadeuterio-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-N-pyridin-2-ylcyclohexane-1-carboxamide.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6-undecadeuterio-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-N-pyridin-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 71752990 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.34 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6-undecadeuterio-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-N-pyridin-2-ylcyclohexane-1-carboxamide |
| SMILES | [2H]C1([2H])C([2H])([2H])C([2H])([2H])C([2H])(C(=O)N(CCN2CCN(c3ccccc3OC)CC2)c2ccccn2)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C25H34N4O2/c1-31-23-12-6-5-11-22(23)28-18-15-27(16-19-28)17-20-29(24-13-7-8-14-26-24)25(30)21-9-3-2-4-10-21/h5-8,11-14,21H,2-4,9-10,15-20H2,1H3/i2D2,3D2,4D2,9D2,10D2,21D |
| InChIKey | SBPRIAGPYFYCRT-DBGRRATNSA-N |
| XLogP | 3.83 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |