C24H31N4O4S- — CID 10344749
[2-[4-[2-[cyclohexanecarbonyl(pyridin-2-yl)amino]ethyl]piperazin-1-yl]phenyl] sulfite (PubChem CID 10344749) has the molecular formula C24H31N4O4S- and a molecular weight of 471.60 g/mol. Its IUPAC name is [2-[4-[2-[cyclohexanecarbonyl(pyridin-2-yl)amino]ethyl]piperazin-1-yl]phenyl] sulfite.
| Compound Name | [2-[4-[2-[cyclohexanecarbonyl(pyridin-2-yl)amino]ethyl]piperazin-1-yl]phenyl] sulfite |
|---|---|
| PubChem CID | 10344749 |
| Molecular Formula | C24H31N4O4S- |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | [2-[4-[2-[cyclohexanecarbonyl(pyridin-2-yl)amino]ethyl]piperazin-1-yl]phenyl] sulfite |
| SMILES | O=C(C1CCCCC1)N(CCN1CCN(c2ccccc2OS(=O)[O-])CC1)c1ccccn1 |
| InChI | InChI=1S/C24H32N4O4S/c29-24(20-8-2-1-3-9-20)28(23-12-6-7-13-25-23)19-16-26-14-17-27(18-15-26)21-10-4-5-11-22(21)32-33(30)31/h4-7,10-13,20H,1-3,8-9,14-19H2,(H,30,31)/p-1 |
| InChIKey | ZAPWDXIISKCQMM-UHFFFAOYSA-M |
| XLogP | 2.99 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|