C25H33IN4O2 — CID 10325198
N-(6-iodo-2-pyridinyl)-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]cyclohexanecarboxamide (PubChem CID 10325198) has the molecular formula C25H33IN4O2 and a molecular weight of 548.47 g/mol. Its IUPAC name is N-(6-iodo-2-pyridinyl)-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]cyclohexanecarboxamide.
| Compound Name | N-(6-iodo-2-pyridinyl)-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 10325198 |
| Molecular Formula | C25H33IN4O2 |
| Molecular Weight | 548.47 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | N-(6-iodo-2-pyridinyl)-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]cyclohexanecarboxamide |
| SMILES | COc1ccccc1N1CCN(CCN(C(=O)C2CCCCC2)c2cccc(I)n2)CC1 |
| InChI | InChI=1S/C25H33IN4O2/c1-32-22-11-6-5-10-21(22)29-17-14-28(15-18-29)16-19-30(24-13-7-12-23(26)27-24)25(31)20-8-3-2-4-9-20/h5-7,10-13,20H,2-4,8-9,14-19H2,1H3 |
| InChIKey | UNGOEPXHZQWLLU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|