C24H32N6O3 — CID 69238758
1-[4-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]butyl]-1-pyrazolo[1,5-a]pyridin-2-ylurea (PubChem CID 69238758) has the molecular formula C24H32N6O3 and a molecular weight of 452.56 g/mol. Its IUPAC name is 1-[4-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]butyl]-1-pyrazolo[1,5-a]pyridin-2-ylurea.
| Compound Name | 1-[4-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]butyl]-1-pyrazolo[1,5-a]pyridin-2-ylurea |
|---|---|
| PubChem CID | 69238758 |
| Molecular Formula | C24H32N6O3 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 1-[4-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]butyl]-1-pyrazolo[1,5-a]pyridin-2-ylurea |
| SMILES | COc1ccc(N2CCN(CCCCN(C(N)=O)c3cc4ccccn4n3)CC2)c(OC)c1 |
| InChI | InChI=1S/C24H32N6O3/c1-32-20-8-9-21(22(18-20)33-2)28-15-13-27(14-16-28)10-5-6-11-29(24(25)31)23-17-19-7-3-4-12-30(19)26-23/h3-4,7-9,12,17-18H,5-6,10-11,13-16H2,1-2H3,(H2,25,31) |
| InChIKey | LFQUVDWLEMXYKD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|