C22H38N4O3 — CID 143404168
2-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]-1-(4-ethylpiperazin-1-yl)ethanone;ethane (PubChem CID 143404168) has the molecular formula C22H38N4O3 and a molecular weight of 406.57 g/mol. Its IUPAC name is 2-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]-1-(4-ethylpiperazin-1-yl)ethanone;ethane.
| Compound Name | 2-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]-1-(4-ethylpiperazin-1-yl)ethanone;ethane |
|---|---|
| PubChem CID | 143404168 |
| Molecular Formula | C22H38N4O3 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | 2-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]-1-(4-ethylpiperazin-1-yl)ethanone;ethane |
| SMILES | CC.CCN1CCN(C(=O)CN2CCN(c3ccc(OC)cc3OC)CC2)CC1 |
| InChI | InChI=1S/C20H32N4O3.C2H6/c1-4-21-7-13-24(14-8-21)20(25)16-22-9-11-23(12-10-22)18-6-5-17(26-2)15-19(18)27-3;1-2/h5-6,15H,4,7-14,16H2,1-3H3;1-2H3 |
| InChIKey | MQWGAUIGGHXUCY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 48.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|