C15H23N3O3 — CID 4740951
3-amino-1-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]propan-1-one (PubChem CID 4740951) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-amino-1-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]propan-1-one.
| Compound Name | 3-amino-1-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 4740951 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 3-amino-1-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]propan-1-one |
| SMILES | COc1ccc(N2CCN(C(=O)CCN)CC2)c(OC)c1 |
| InChI | InChI=1S/C15H23N3O3/c1-20-12-3-4-13(14(11-12)21-2)17-7-9-18(10-8-17)15(19)5-6-16/h3-4,11H,5-10,16H2,1-2H3 |
| InChIKey | DFIVAKVOBGXKCZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|