C21H26FN3O3 — CID 113109057
4-(2,4-dimethoxyphenyl)-N-[2-(2-fluorophenyl)ethyl]piperazine-1-carboxamide (PubChem CID 113109057) has the molecular formula C21H26FN3O3 and a molecular weight of 387.46 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-N-[2-(2-fluorophenyl)ethyl]piperazine-1-carboxamide.
| Compound Name | 4-(2,4-dimethoxyphenyl)-N-[2-(2-fluorophenyl)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113109057 |
| Molecular Formula | C21H26FN3O3 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-N-[2-(2-fluorophenyl)ethyl]piperazine-1-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=O)NCCc3ccccc3F)CC2)c(OC)c1 |
| InChI | InChI=1S/C21H26FN3O3/c1-27-17-7-8-19(20(15-17)28-2)24-11-13-25(14-12-24)21(26)23-10-9-16-5-3-4-6-18(16)22/h3-8,15H,9-14H2,1-2H3,(H,23,26) |
| InChIKey | DWHGMHJDGKPAGX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|