C19H29BrN4O2 — CID 57442580
2-[4-(4-bromo-3-methoxyphenyl)piperazin-1-yl]-1-(4-ethylpiperazin-1-yl)ethanone (PubChem CID 57442580) has the molecular formula C19H29BrN4O2 and a molecular weight of 425.37 g/mol. Its IUPAC name is 2-[4-(4-bromo-3-methoxyphenyl)piperazin-1-yl]-1-(4-ethylpiperazin-1-yl)ethanone.
| Compound Name | 2-[4-(4-bromo-3-methoxyphenyl)piperazin-1-yl]-1-(4-ethylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 57442580 |
| Molecular Formula | C19H29BrN4O2 |
| Molecular Weight | 425.37 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-[4-(4-bromo-3-methoxyphenyl)piperazin-1-yl]-1-(4-ethylpiperazin-1-yl)ethanone |
| SMILES | CCN1CCN(C(=O)CN2CCN(c3ccc(Br)c(OC)c3)CC2)CC1 |
| InChI | InChI=1S/C19H29BrN4O2/c1-3-21-6-12-24(13-7-21)19(25)15-22-8-10-23(11-9-22)16-4-5-17(20)18(14-16)26-2/h4-5,14H,3,6-13,15H2,1-2H3 |
| InChIKey | DDZAKJCXXKDARS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |