C24H30ClN5O2 — CID 141135456
1-[4-[4-(3-chloro-2-methoxyphenyl)piperazin-1-yl]butyl]-1-indolizin-2-ylurea (PubChem CID 141135456) has the molecular formula C24H30ClN5O2 and a molecular weight of 455.99 g/mol. Its IUPAC name is 1-[4-[4-(3-chloro-2-methoxyphenyl)piperazin-1-yl]butyl]-1-indolizin-2-ylurea.
| Compound Name | 1-[4-[4-(3-chloro-2-methoxyphenyl)piperazin-1-yl]butyl]-1-indolizin-2-ylurea |
|---|---|
| PubChem CID | 141135456 |
| Molecular Formula | C24H30ClN5O2 |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 1-[4-[4-(3-chloro-2-methoxyphenyl)piperazin-1-yl]butyl]-1-indolizin-2-ylurea |
| SMILES | COc1c(Cl)cccc1N1CCN(CCCCN(C(N)=O)c2cc3ccccn3c2)CC1 |
| InChI | InChI=1S/C24H30ClN5O2/c1-32-23-21(25)8-6-9-22(23)28-15-13-27(14-16-28)10-4-5-12-30(24(26)31)20-17-19-7-2-3-11-29(19)18-20/h2-3,6-9,11,17-18H,4-5,10,12-16H2,1H3,(H2,26,31) |
| InChIKey | OPHNSEKJYVFEQP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 66.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|