C23H25BrCl2N4O2 — CID 69465676
1-(5-bromo-1-benzofuran-2-yl)-1-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]urea (PubChem CID 69465676) has the molecular formula C23H25BrCl2N4O2 and a molecular weight of 540.29 g/mol. Its IUPAC name is 1-(5-bromo-1-benzofuran-2-yl)-1-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]urea.
| Compound Name | 1-(5-bromo-1-benzofuran-2-yl)-1-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]urea |
|---|---|
| PubChem CID | 69465676 |
| Molecular Formula | C23H25BrCl2N4O2 |
| Molecular Weight | 540.29 g/mol |
| Exact Mass | 538.05 |
| IUPAC Name | 1-(5-bromo-1-benzofuran-2-yl)-1-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]urea |
| SMILES | NC(=O)N(CCCCN1CCN(c2cccc(Cl)c2Cl)CC1)c1cc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C23H25BrCl2N4O2/c24-17-6-7-20-16(14-17)15-21(32-20)30(23(27)31)9-2-1-8-28-10-12-29(13-11-28)19-5-3-4-18(25)22(19)26/h3-7,14-15H,1-2,8-13H2,(H2,27,31) |
| InChIKey | YLFFQGWUFIPHHK-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 65.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.29 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|