C21H25Cl2N7O — CID 69239250
1-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1-([1,2,4]triazolo[1,5-a]pyridin-2-yl)urea (PubChem CID 69239250) has the molecular formula C21H25Cl2N7O and a molecular weight of 462.39 g/mol. Its IUPAC name is 1-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1-([1,2,4]triazolo[1,5-a]pyridin-2-yl)urea.
| Compound Name | 1-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1-([1,2,4]triazolo[1,5-a]pyridin-2-yl)urea |
|---|---|
| PubChem CID | 69239250 |
| Molecular Formula | C21H25Cl2N7O |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 1-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1-([1,2,4]triazolo[1,5-a]pyridin-2-yl)urea |
| SMILES | NC(=O)N(CCCCN1CCN(c2cccc(Cl)c2Cl)CC1)c1nc2ccccn2n1 |
| InChI | InChI=1S/C21H25Cl2N7O/c22-16-6-5-7-17(19(16)23)28-14-12-27(13-15-28)9-3-4-10-29(20(24)31)21-25-18-8-1-2-11-30(18)26-21/h1-2,5-8,11H,3-4,9-10,12-15H2,(H2,24,31) |
| InChIKey | HYYLQSPFUZSLOJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 83.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|