C24H25Cl2N3O4 — CID 139958738
1'-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]spiro[1,3-dioxolane-2,2'-3H-indole]-4,5-dione (PubChem CID 139958738) has the molecular formula C24H25Cl2N3O4 and a molecular weight of 490.39 g/mol. Its IUPAC name is 1'-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]spiro[1,3-dioxolane-2,2'-3H-indole]-4,5-dione.
| Compound Name | 1'-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]spiro[1,3-dioxolane-2,2'-3H-indole]-4,5-dione |
|---|---|
| PubChem CID | 139958738 |
| Molecular Formula | C24H25Cl2N3O4 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 1'-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]spiro[1,3-dioxolane-2,2'-3H-indole]-4,5-dione |
| SMILES | O=C1OC2(Cc3ccccc3N2CCCCN2CCN(c3cccc(Cl)c3Cl)CC2)OC1=O |
| InChI | InChI=1S/C24H25Cl2N3O4/c25-18-7-5-9-20(21(18)26)28-14-12-27(13-15-28)10-3-4-11-29-19-8-2-1-6-17(19)16-24(29)32-22(30)23(31)33-24/h1-2,5-9H,3-4,10-16H2 |
| InChIKey | HHUILLJUWSIJLV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|