C19H29Cl2N3O — CID 146025635
1-(2,3-dichlorophenyl)-4-(4-piperidin-4-yloxybutyl)piperazine (PubChem CID 146025635) has the molecular formula C19H29Cl2N3O and a molecular weight of 386.37 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-4-(4-piperidin-4-yloxybutyl)piperazine.
| Compound Name | 1-(2,3-dichlorophenyl)-4-(4-piperidin-4-yloxybutyl)piperazine |
|---|---|
| PubChem CID | 146025635 |
| Molecular Formula | C19H29Cl2N3O |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-4-(4-piperidin-4-yloxybutyl)piperazine |
| SMILES | Clc1cccc(N2CCN(CCCCOC3CCNCC3)CC2)c1Cl |
| InChI | InChI=1S/C19H29Cl2N3O/c20-17-4-3-5-18(19(17)21)24-13-11-23(12-14-24)10-1-2-15-25-16-6-8-22-9-7-16/h3-5,16,22H,1-2,6-15H2 |
| InChIKey | RXXAWBPCGRBWKM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|