C22H23Cl2N3O2 — CID 69164528
6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]isoindol-1-one (PubChem CID 69164528) has the molecular formula C22H23Cl2N3O2 and a molecular weight of 432.35 g/mol. Its IUPAC name is 6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]isoindol-1-one.
| Compound Name | 6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]isoindol-1-one |
|---|---|
| PubChem CID | 69164528 |
| Molecular Formula | C22H23Cl2N3O2 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]isoindol-1-one |
| SMILES | O=C1N=Cc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C22H23Cl2N3O2/c23-19-4-3-5-20(21(19)24)27-11-9-26(10-12-27)8-1-2-13-29-17-7-6-16-15-25-22(28)18(16)14-17/h3-7,14-15H,1-2,8-13H2 |
| InChIKey | RDHKSLFUXSEWBR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|