C29H34Cl2N3O2P — CID 174534037
7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one;phenylphosphane (PubChem CID 174534037) has the molecular formula C29H34Cl2N3O2P and a molecular weight of 558.49 g/mol. Its IUPAC name is 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one;phenylphosphane.
| Compound Name | 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one;phenylphosphane |
|---|---|
| PubChem CID | 174534037 |
| Molecular Formula | C29H34Cl2N3O2P |
| Molecular Weight | 558.49 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one;phenylphosphane |
| SMILES | O=C1CCc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc2N1.Pc1ccccc1 |
| InChI | InChI=1S/C23H27Cl2N3O2.C6H7P/c24-19-4-3-5-21(23(19)25)28-13-11-27(12-14-28)10-1-2-15-30-18-8-6-17-7-9-22(29)26-20(17)16-18;7-6-4-2-1-3-5-6/h3-6,8,16H,1-2,7,9-15H2,(H,26,29);1-5H,7H2 |
| InChIKey | LUJBVTJGRJNVMS-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.49 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|