C22H25Cl2N3O3 — CID 58807602
7-[3-[4-(2,3-dichloro-4-hydroxyphenyl)piperazin-1-yl]propoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 58807602) has the molecular formula C22H25Cl2N3O3 and a molecular weight of 450.37 g/mol. Its IUPAC name is 7-[3-[4-(2,3-dichloro-4-hydroxyphenyl)piperazin-1-yl]propoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-[3-[4-(2,3-dichloro-4-hydroxyphenyl)piperazin-1-yl]propoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 58807602 |
| Molecular Formula | C22H25Cl2N3O3 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 7-[3-[4-(2,3-dichloro-4-hydroxyphenyl)piperazin-1-yl]propoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2ccc(OCCCN3CCN(c4ccc(O)c(Cl)c4Cl)CC3)cc2N1 |
| InChI | InChI=1S/C22H25Cl2N3O3/c23-21-18(5-6-19(28)22(21)24)27-11-9-26(10-12-27)8-1-13-30-16-4-2-15-3-7-20(29)25-17(15)14-16/h2,4-6,14,28H,1,3,7-13H2,(H,25,29) |
| InChIKey | GWLZLESAJBNBHY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|