C23H28Cl2N4O2 — CID 11951410
8-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-1,3,4,5-tetrahydro-1,3-benzodiazepin-2-one (PubChem CID 11951410) has the molecular formula C23H28Cl2N4O2 and a molecular weight of 463.41 g/mol. Its IUPAC name is 8-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-1,3,4,5-tetrahydro-1,3-benzodiazepin-2-one.
| Compound Name | 8-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-1,3,4,5-tetrahydro-1,3-benzodiazepin-2-one |
|---|---|
| PubChem CID | 11951410 |
| Molecular Formula | C23H28Cl2N4O2 |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 8-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-1,3,4,5-tetrahydro-1,3-benzodiazepin-2-one |
| SMILES | O=C1NCCc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc2N1 |
| InChI | InChI=1S/C23H28Cl2N4O2/c24-19-4-3-5-21(22(19)25)29-13-11-28(12-14-29)10-1-2-15-31-18-7-6-17-8-9-26-23(30)27-20(17)16-18/h3-7,16H,1-2,8-15H2,(H2,26,27,30) |
| InChIKey | HVGZNQHZSHCPTC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|