C26H25F2N3O2 — CID 69164306
6-[4-[4-(6,7-difluoronaphthalen-1-yl)piperazin-1-yl]butoxy]isoindol-1-one (PubChem CID 69164306) has the molecular formula C26H25F2N3O2 and a molecular weight of 449.50 g/mol. Its IUPAC name is 6-[4-[4-(6,7-difluoronaphthalen-1-yl)piperazin-1-yl]butoxy]isoindol-1-one.
| Compound Name | 6-[4-[4-(6,7-difluoronaphthalen-1-yl)piperazin-1-yl]butoxy]isoindol-1-one |
|---|---|
| PubChem CID | 69164306 |
| Molecular Formula | C26H25F2N3O2 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 6-[4-[4-(6,7-difluoronaphthalen-1-yl)piperazin-1-yl]butoxy]isoindol-1-one |
| SMILES | O=C1N=Cc2ccc(OCCCCN3CCN(c4cccc5cc(F)c(F)cc45)CC3)cc21 |
| InChI | InChI=1S/C26H25F2N3O2/c27-23-14-18-4-3-5-25(21(18)16-24(23)28)31-11-9-30(10-12-31)8-1-2-13-33-20-7-6-19-17-29-26(32)22(19)15-20/h3-7,14-17H,1-2,8-13H2 |
| InChIKey | LVGUKGVLUNOYFI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|