C28H33N5O3 — CID 21073229
2-[4-[4-(7-methoxynaphthalen-1-yl)piperazin-1-yl]butoxy]-4,8-dimethylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 21073229) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is 2-[4-[4-(7-methoxynaphthalen-1-yl)piperazin-1-yl]butoxy]-4,8-dimethylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-[4-[4-(7-methoxynaphthalen-1-yl)piperazin-1-yl]butoxy]-4,8-dimethylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 21073229 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 2-[4-[4-(7-methoxynaphthalen-1-yl)piperazin-1-yl]butoxy]-4,8-dimethylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | COc1ccc2cccc(N3CCN(CCCCOc4nc(C)c5ccc(=O)n(C)c5n4)CC3)c2c1 |
| InChI | InChI=1S/C28H33N5O3/c1-20-23-11-12-26(34)31(2)27(23)30-28(29-20)36-18-5-4-13-32-14-16-33(17-15-32)25-8-6-7-21-9-10-22(35-3)19-24(21)25/h6-12,19H,4-5,13-18H2,1-3H3 |
| InChIKey | YAPRFXGRPWUEJL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|