C20H28ClN3O3 — CID 19808500
ethyl N-[2-[4-(7-methoxynaphthalen-1-yl)piperazin-1-yl]ethyl]carbamate;hydrochloride (PubChem CID 19808500) has the molecular formula C20H28ClN3O3 and a molecular weight of 393.92 g/mol. Its IUPAC name is ethyl N-[2-[4-(7-methoxynaphthalen-1-yl)piperazin-1-yl]ethyl]carbamate;hydrochloride.
| Compound Name | ethyl N-[2-[4-(7-methoxynaphthalen-1-yl)piperazin-1-yl]ethyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 19808500 |
| Molecular Formula | C20H28ClN3O3 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | ethyl N-[2-[4-(7-methoxynaphthalen-1-yl)piperazin-1-yl]ethyl]carbamate;hydrochloride |
| SMILES | CCOC(=O)NCCN1CCN(c2cccc3ccc(OC)cc23)CC1.Cl |
| InChI | InChI=1S/C20H27N3O3.ClH/c1-3-26-20(24)21-9-10-22-11-13-23(14-12-22)19-6-4-5-16-7-8-17(25-2)15-18(16)19;/h4-8,15H,3,9-14H2,1-2H3,(H,21,24);1H |
| InChIKey | PYVPZKLLCPDMCF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |