C19H32ClN3O2S — CID 117067142
ethyl N-[3-[4-(2-propan-2-ylsulfanylphenyl)piperazin-1-yl]propyl]carbamate;hydrochloride (PubChem CID 117067142) has the molecular formula C19H32ClN3O2S and a molecular weight of 402.00 g/mol. Its IUPAC name is ethyl N-[3-[4-(2-propan-2-ylsulfanylphenyl)piperazin-1-yl]propyl]carbamate;hydrochloride.
| Compound Name | ethyl N-[3-[4-(2-propan-2-ylsulfanylphenyl)piperazin-1-yl]propyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 117067142 |
| Molecular Formula | C19H32ClN3O2S |
| Molecular Weight | 402.00 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | ethyl N-[3-[4-(2-propan-2-ylsulfanylphenyl)piperazin-1-yl]propyl]carbamate;hydrochloride |
| SMILES | CCOC(=O)NCCCN1CCN(c2ccccc2SC(C)C)CC1.Cl |
| InChI | InChI=1S/C19H31N3O2S.ClH/c1-4-24-19(23)20-10-7-11-21-12-14-22(15-13-21)17-8-5-6-9-18(17)25-16(2)3;/h5-6,8-9,16H,4,7,10-15H2,1-3H3,(H,20,23);1H |
| InChIKey | LUNCAUHYTZTXGC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.00 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|