C18H29N3O2S — CID 97355649
methyl N-[3-[4-(2-propan-2-ylsulfanylphenyl)piperazin-1-yl]propyl]carbamate (PubChem CID 97355649) has the molecular formula C18H29N3O2S and a molecular weight of 351.52 g/mol. Its IUPAC name is methyl N-[3-[4-(2-propan-2-ylsulfanylphenyl)piperazin-1-yl]propyl]carbamate.
| Compound Name | methyl N-[3-[4-(2-propan-2-ylsulfanylphenyl)piperazin-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 97355649 |
| Molecular Formula | C18H29N3O2S |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | methyl N-[3-[4-(2-propan-2-ylsulfanylphenyl)piperazin-1-yl]propyl]carbamate |
| SMILES | COC(=O)NCCCN1CCN(c2ccccc2SC(C)C)CC1 |
| InChI | InChI=1S/C18H29N3O2S/c1-15(2)24-17-8-5-4-7-16(17)21-13-11-20(12-14-21)10-6-9-19-18(22)23-3/h4-5,7-8,15H,6,9-14H2,1-3H3,(H,19,22) |
| InChIKey | GYRFPSMKLWUZBI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|