C19H31N3O2S — CID 97355608
3-[4-(2-propylsulfanylphenyl)piperazin-1-yl]propyl N-ethylcarbamate (PubChem CID 97355608) has the molecular formula C19H31N3O2S and a molecular weight of 365.54 g/mol. Its IUPAC name is 3-[4-(2-propylsulfanylphenyl)piperazin-1-yl]propyl N-ethylcarbamate.
| Compound Name | 3-[4-(2-propylsulfanylphenyl)piperazin-1-yl]propyl N-ethylcarbamate |
|---|---|
| PubChem CID | 97355608 |
| Molecular Formula | C19H31N3O2S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 3-[4-(2-propylsulfanylphenyl)piperazin-1-yl]propyl N-ethylcarbamate |
| SMILES | CCCSc1ccccc1N1CCN(CCCOC(=O)NCC)CC1 |
| InChI | InChI=1S/C19H31N3O2S/c1-3-16-25-18-9-6-5-8-17(18)22-13-11-21(12-14-22)10-7-15-24-19(23)20-4-2/h5-6,8-9H,3-4,7,10-16H2,1-2H3,(H,20,23) |
| InChIKey | IVGNHUAYBXSWGC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|