C22H34N4O2S — CID 97356524
3-[6-[4-(2-propylsulfanylphenyl)piperazin-1-yl]hexyl]imidazolidine-2,4-dione (PubChem CID 97356524) has the molecular formula C22H34N4O2S and a molecular weight of 418.61 g/mol. Its IUPAC name is 3-[6-[4-(2-propylsulfanylphenyl)piperazin-1-yl]hexyl]imidazolidine-2,4-dione.
| Compound Name | 3-[6-[4-(2-propylsulfanylphenyl)piperazin-1-yl]hexyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97356524 |
| Molecular Formula | C22H34N4O2S |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 3-[6-[4-(2-propylsulfanylphenyl)piperazin-1-yl]hexyl]imidazolidine-2,4-dione |
| SMILES | CCCSc1ccccc1N1CCN(CCCCCCN2C(=O)CNC2=O)CC1 |
| InChI | InChI=1S/C22H34N4O2S/c1-2-17-29-20-10-6-5-9-19(20)25-15-13-24(14-16-25)11-7-3-4-8-12-26-21(27)18-23-22(26)28/h5-6,9-10H,2-4,7-8,11-18H2,1H3,(H,23,28) |
| InChIKey | NOCKVQWMLCWVBV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|