C18H30N2OS — CID 97355562
6-[4-(2-ethylsulfanylphenyl)piperazin-1-yl]hexan-1-ol (PubChem CID 97355562) has the molecular formula C18H30N2OS and a molecular weight of 322.52 g/mol. Its IUPAC name is 6-[4-(2-ethylsulfanylphenyl)piperazin-1-yl]hexan-1-ol.
| Compound Name | 6-[4-(2-ethylsulfanylphenyl)piperazin-1-yl]hexan-1-ol |
|---|---|
| PubChem CID | 97355562 |
| Molecular Formula | C18H30N2OS |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 6-[4-(2-ethylsulfanylphenyl)piperazin-1-yl]hexan-1-ol |
| SMILES | CCSc1ccccc1N1CCN(CCCCCCO)CC1 |
| InChI | InChI=1S/C18H30N2OS/c1-2-22-18-10-6-5-9-17(18)20-14-12-19(13-15-20)11-7-3-4-8-16-21/h5-6,9-10,21H,2-4,7-8,11-16H2,1H3 |
| InChIKey | LQVFQKFARCDWKG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|