C29H34ClN3O2S — CID 117068397
1-[3-[4-(2-ethylsulfanylphenyl)piperazin-1-yl]propyl]-3-naphthalen-1-ylpyrrolidine-2,5-dione;hydrochloride (PubChem CID 117068397) has the molecular formula C29H34ClN3O2S and a molecular weight of 524.13 g/mol. Its IUPAC name is 1-[3-[4-(2-ethylsulfanylphenyl)piperazin-1-yl]propyl]-3-naphthalen-1-ylpyrrolidine-2,5-dione;hydrochloride.
| Compound Name | 1-[3-[4-(2-ethylsulfanylphenyl)piperazin-1-yl]propyl]-3-naphthalen-1-ylpyrrolidine-2,5-dione;hydrochloride |
|---|---|
| PubChem CID | 117068397 |
| Molecular Formula | C29H34ClN3O2S |
| Molecular Weight | 524.13 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | 1-[3-[4-(2-ethylsulfanylphenyl)piperazin-1-yl]propyl]-3-naphthalen-1-ylpyrrolidine-2,5-dione;hydrochloride |
| SMILES | CCSc1ccccc1N1CCN(CCCN2C(=O)CC(c3cccc4ccccc34)C2=O)CC1.Cl |
| InChI | InChI=1S/C29H33N3O2S.ClH/c1-2-35-27-14-6-5-13-26(27)31-19-17-30(18-20-31)15-8-16-32-28(33)21-25(29(32)34)24-12-7-10-22-9-3-4-11-23(22)24;/h3-7,9-14,25H,2,8,15-21H2,1H3;1H |
| InChIKey | HAQHHDYKGUDWJI-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.13 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|