C17H25ClN2O2 — CID 10616008
propyl 2-[4-(3-chloropropyl)piperazin-1-yl]benzoate (PubChem CID 10616008) has the molecular formula C17H25ClN2O2 and a molecular weight of 324.85 g/mol. Its IUPAC name is propyl 2-[4-(3-chloropropyl)piperazin-1-yl]benzoate.
| Compound Name | propyl 2-[4-(3-chloropropyl)piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 10616008 |
| Molecular Formula | C17H25ClN2O2 |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | propyl 2-[4-(3-chloropropyl)piperazin-1-yl]benzoate |
| SMILES | CCCOC(=O)c1ccccc1N1CCN(CCCCl)CC1 |
| InChI | InChI=1S/C17H25ClN2O2/c1-2-14-22-17(21)15-6-3-4-7-16(15)20-12-10-19(11-13-20)9-5-8-18/h3-4,6-7H,2,5,8-14H2,1H3 |
| InChIKey | OQGNTTNAUKSVAZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|