C25H32N2O5 — CID 139690631
ethyl 2-[4-[4-(4-acetyloxyphenoxy)butyl]piperazin-1-yl]benzoate (PubChem CID 139690631) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is ethyl 2-[4-[4-(4-acetyloxyphenoxy)butyl]piperazin-1-yl]benzoate.
| Compound Name | ethyl 2-[4-[4-(4-acetyloxyphenoxy)butyl]piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 139690631 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | ethyl 2-[4-[4-(4-acetyloxyphenoxy)butyl]piperazin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccccc1N1CCN(CCCCOc2ccc(OC(C)=O)cc2)CC1 |
| InChI | InChI=1S/C25H32N2O5/c1-3-30-25(29)23-8-4-5-9-24(23)27-17-15-26(16-18-27)14-6-7-19-31-21-10-12-22(13-11-21)32-20(2)28/h4-5,8-13H,3,6-7,14-19H2,1-2H3 |
| InChIKey | HXKMSLXVICWKEC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|