C34H44N2O7 — CID 158229154
3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl 2-[(3,4,5-triethoxyphenyl)methoxy]benzoate (PubChem CID 158229154) has the molecular formula C34H44N2O7 and a molecular weight of 592.73 g/mol. Its IUPAC name is 3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl 2-[(3,4,5-triethoxyphenyl)methoxy]benzoate.
| Compound Name | 3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl 2-[(3,4,5-triethoxyphenyl)methoxy]benzoate |
|---|---|
| PubChem CID | 158229154 |
| Molecular Formula | C34H44N2O7 |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.31 |
| IUPAC Name | 3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl 2-[(3,4,5-triethoxyphenyl)methoxy]benzoate |
| SMILES | CCOc1cc(COc2ccccc2C(=O)OCCCN2CCN(c3ccccc3OC)CC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C34H44N2O7/c1-5-39-31-23-26(24-32(40-6-2)33(31)41-7-3)25-43-29-15-10-8-13-27(29)34(37)42-22-12-17-35-18-20-36(21-19-35)28-14-9-11-16-30(28)38-4/h8-11,13-16,23-24H,5-7,12,17-22,25H2,1-4H3 |
| InChIKey | GEDYSYMSQUGTQE-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 78.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|