C28H34ClN3O3 — CID 90467592
(4-benzylphenyl) N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]carbamate;hydrochloride (PubChem CID 90467592) has the molecular formula C28H34ClN3O3 and a molecular weight of 496.05 g/mol. Its IUPAC name is (4-benzylphenyl) N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]carbamate;hydrochloride.
| Compound Name | (4-benzylphenyl) N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 90467592 |
| Molecular Formula | C28H34ClN3O3 |
| Molecular Weight | 496.05 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | (4-benzylphenyl) N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]carbamate;hydrochloride |
| SMILES | COc1ccccc1N1CCN(CCCNC(=O)Oc2ccc(Cc3ccccc3)cc2)CC1.Cl |
| InChI | InChI=1S/C28H33N3O3.ClH/c1-33-27-11-6-5-10-26(27)31-20-18-30(19-21-31)17-7-16-29-28(32)34-25-14-12-24(13-15-25)22-23-8-3-2-4-9-23;/h2-6,8-15H,7,16-22H2,1H3,(H,29,32);1H |
| InChIKey | HFTLWOTZKXGLHY-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.05 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|