C30H36N4O5 — CID 90467323
[4-(3-carbamoylphenyl)-3-methoxyphenyl] N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]carbamate (PubChem CID 90467323) has the molecular formula C30H36N4O5 and a molecular weight of 532.64 g/mol. Its IUPAC name is [4-(3-carbamoylphenyl)-3-methoxyphenyl] N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]carbamate.
| Compound Name | [4-(3-carbamoylphenyl)-3-methoxyphenyl] N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]carbamate |
|---|---|
| PubChem CID | 90467323 |
| Molecular Formula | C30H36N4O5 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | [4-(3-carbamoylphenyl)-3-methoxyphenyl] N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]carbamate |
| SMILES | COc1cc(OC(=O)NCCCCN2CCN(c3ccccc3OC)CC2)ccc1-c1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C30H36N4O5/c1-37-27-11-4-3-10-26(27)34-18-16-33(17-19-34)15-6-5-14-32-30(36)39-24-12-13-25(28(21-24)38-2)22-8-7-9-23(20-22)29(31)35/h3-4,7-13,20-21H,5-6,14-19H2,1-2H3,(H2,31,35)(H,32,36) |
| InChIKey | LDYKPEZBHFCCGD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|