C25H29N3O3 — CID 69163669
6-[4-[4-(3,4-dihydro-1H-isochromen-5-yl)piperazin-1-yl]butoxy]isoindol-1-one (PubChem CID 69163669) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 6-[4-[4-(3,4-dihydro-1H-isochromen-5-yl)piperazin-1-yl]butoxy]isoindol-1-one.
| Compound Name | 6-[4-[4-(3,4-dihydro-1H-isochromen-5-yl)piperazin-1-yl]butoxy]isoindol-1-one |
|---|---|
| PubChem CID | 69163669 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 6-[4-[4-(3,4-dihydro-1H-isochromen-5-yl)piperazin-1-yl]butoxy]isoindol-1-one |
| SMILES | O=C1N=Cc2ccc(OCCCCN3CCN(c4cccc5c4CCOC5)CC3)cc21 |
| InChI | InChI=1S/C25H29N3O3/c29-25-23-16-21(7-6-19(23)17-26-25)31-14-2-1-9-27-10-12-28(13-11-27)24-5-3-4-20-18-30-15-8-22(20)24/h3-7,16-17H,1-2,8-15,18H2 |
| InChIKey | RWPFMZJUNOXMOA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|