C25H30N4O3 — CID 21073805
7-[4-[4-(3,4-dihydro-1H-isochromen-8-yl)piperazin-1-yl]butoxy]-1H-1,8-naphthyridin-2-one (PubChem CID 21073805) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 7-[4-[4-(3,4-dihydro-1H-isochromen-8-yl)piperazin-1-yl]butoxy]-1H-1,8-naphthyridin-2-one.
| Compound Name | 7-[4-[4-(3,4-dihydro-1H-isochromen-8-yl)piperazin-1-yl]butoxy]-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 21073805 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 7-[4-[4-(3,4-dihydro-1H-isochromen-8-yl)piperazin-1-yl]butoxy]-1H-1,8-naphthyridin-2-one |
| SMILES | O=c1ccc2ccc(OCCCCN3CCN(c4cccc5c4COCC5)CC3)nc2[nH]1 |
| InChI | InChI=1S/C25H30N4O3/c30-23-8-6-20-7-9-24(27-25(20)26-23)32-16-2-1-11-28-12-14-29(15-13-28)22-5-3-4-19-10-17-31-18-21(19)22/h3-9H,1-2,10-18H2,(H,26,27,30) |
| InChIKey | IMRMRSSLGAUFLV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 70.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|