C25H32N4O3 — CID 21073431
6-[4-[4-(5,6,7,8-tetrahydronaphthalen-1-yl)piperazin-1-yl]butoxy]-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 21073431) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is 6-[4-[4-(5,6,7,8-tetrahydronaphthalen-1-yl)piperazin-1-yl]butoxy]-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 6-[4-[4-(5,6,7,8-tetrahydronaphthalen-1-yl)piperazin-1-yl]butoxy]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 21073431 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 6-[4-[4-(5,6,7,8-tetrahydronaphthalen-1-yl)piperazin-1-yl]butoxy]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | O=C1COc2ccc(OCCCCN3CCN(c4cccc5c4CCCC5)CC3)nc2N1 |
| InChI | InChI=1S/C25H32N4O3/c30-23-18-32-22-10-11-24(27-25(22)26-23)31-17-4-3-12-28-13-15-29(16-14-28)21-9-5-7-19-6-1-2-8-20(19)21/h5,7,9-11H,1-4,6,8,12-18H2,(H,26,27,30) |
| InChIKey | ZXEHFRJHBYXGKM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|