C18H28N2 — CID 20795261
1-butyl-4-(5,6,7,8-tetrahydronaphthalen-1-yl)piperazine (PubChem CID 20795261) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 1-butyl-4-(5,6,7,8-tetrahydronaphthalen-1-yl)piperazine.
| Compound Name | 1-butyl-4-(5,6,7,8-tetrahydronaphthalen-1-yl)piperazine |
|---|---|
| PubChem CID | 20795261 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 1-butyl-4-(5,6,7,8-tetrahydronaphthalen-1-yl)piperazine |
| SMILES | CCCCN1CCN(c2cccc3c2CCCC3)CC1 |
| InChI | InChI=1S/C18H28N2/c1-2-3-11-19-12-14-20(15-13-19)18-10-6-8-16-7-4-5-9-17(16)18/h6,8,10H,2-5,7,9,11-15H2,1H3 |
| InChIKey | POXVBHBUUUXBTM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |