C32H37ClN4O2 — CID 44532569
4-[(4-chlorobenzoyl)amino]-N-[4-[4-(5,6,7,8-tetrahydronaphthalen-1-yl)piperazin-1-yl]butyl]benzamide (PubChem CID 44532569) has the molecular formula C32H37ClN4O2 and a molecular weight of 545.13 g/mol. Its IUPAC name is 4-[(4-chlorobenzoyl)amino]-N-[4-[4-(5,6,7,8-tetrahydronaphthalen-1-yl)piperazin-1-yl]butyl]benzamide.
| Compound Name | 4-[(4-chlorobenzoyl)amino]-N-[4-[4-(5,6,7,8-tetrahydronaphthalen-1-yl)piperazin-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 44532569 |
| Molecular Formula | C32H37ClN4O2 |
| Molecular Weight | 545.13 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | 4-[(4-chlorobenzoyl)amino]-N-[4-[4-(5,6,7,8-tetrahydronaphthalen-1-yl)piperazin-1-yl]butyl]benzamide |
| SMILES | O=C(NCCCCN1CCN(c2cccc3c2CCCC3)CC1)c1ccc(NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C32H37ClN4O2/c33-27-14-10-26(11-15-27)32(39)35-28-16-12-25(13-17-28)31(38)34-18-3-4-19-36-20-22-37(23-21-36)30-9-5-7-24-6-1-2-8-29(24)30/h5,7,9-17H,1-4,6,8,18-23H2,(H,34,38)(H,35,39) |
| InChIKey | FTOWKFNPHKVSIR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.13 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|