C30H32ClN3O5 — CID 44532406
N-[4-[4-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-1-yl]butyl]-4-[(4-chlorobenzoyl)amino]benzamide (PubChem CID 44532406) has the molecular formula C30H32ClN3O5 and a molecular weight of 550.06 g/mol. Its IUPAC name is N-[4-[4-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-1-yl]butyl]-4-[(4-chlorobenzoyl)amino]benzamide.
| Compound Name | N-[4-[4-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-1-yl]butyl]-4-[(4-chlorobenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 44532406 |
| Molecular Formula | C30H32ClN3O5 |
| Molecular Weight | 550.06 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | N-[4-[4-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-1-yl]butyl]-4-[(4-chlorobenzoyl)amino]benzamide |
| SMILES | O=C(NCCCCN1CCC(O)(c2ccc3c(c2)OCO3)CC1)c1ccc(NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C30H32ClN3O5/c31-24-8-3-22(4-9-24)29(36)33-25-10-5-21(6-11-25)28(35)32-15-1-2-16-34-17-13-30(37,14-18-34)23-7-12-26-27(19-23)39-20-38-26/h3-12,19,37H,1-2,13-18,20H2,(H,32,35)(H,33,36) |
| InChIKey | YWVRWBUUHCFUKR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.06 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|