C14H20N2 — CID 59726261
1-(2,3-dihydro-1H-inden-4-yl)-4-methylpiperazine (PubChem CID 59726261) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-4-yl)-4-methylpiperazine.
| Compound Name | 1-(2,3-dihydro-1H-inden-4-yl)-4-methylpiperazine |
|---|---|
| PubChem CID | 59726261 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-4-yl)-4-methylpiperazine |
| SMILES | CN1CCN(c2cccc3c2CCC3)CC1 |
| InChI | InChI=1S/C14H20N2/c1-15-8-10-16(11-9-15)14-7-3-5-12-4-2-6-13(12)14/h3,5,7H,2,4,6,8-11H2,1H3 |
| InChIKey | WAJLRUYCFMHPTR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |