C22H26N6O3 — CID 69419353
7-[4-[4-(2,1,3-benzoxadiazol-4-yl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 69419353) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is 7-[4-[4-(2,1,3-benzoxadiazol-4-yl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 7-[4-[4-(2,1,3-benzoxadiazol-4-yl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 69419353 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 7-[4-[4-(2,1,3-benzoxadiazol-4-yl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | O=C1CCc2ccc(OCCCCN3CCN(c4cccc5nonc45)CC3)nc2N1 |
| InChI | InChI=1S/C22H26N6O3/c29-19-8-6-16-7-9-20(24-22(16)23-19)30-15-2-1-10-27-11-13-28(14-12-27)18-5-3-4-17-21(18)26-31-25-17/h3-5,7,9H,1-2,6,8,10-15H2,(H,23,24,29) |
| InChIKey | YGVCULPKYAVSAX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|