C25H30N6O2 — CID 56598477
7-[4-(4-quinazolin-4-yl-1,4-diazepan-1-yl)butoxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 56598477) has the molecular formula C25H30N6O2 and a molecular weight of 446.56 g/mol. Its IUPAC name is 7-[4-(4-quinazolin-4-yl-1,4-diazepan-1-yl)butoxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 7-[4-(4-quinazolin-4-yl-1,4-diazepan-1-yl)butoxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 56598477 |
| Molecular Formula | C25H30N6O2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 7-[4-(4-quinazolin-4-yl-1,4-diazepan-1-yl)butoxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | O=C1CCc2ccc(OCCCCN3CCCN(c4ncnc5ccccc45)CC3)nc2N1 |
| InChI | InChI=1S/C25H30N6O2/c32-22-10-8-19-9-11-23(29-24(19)28-22)33-17-4-3-12-30-13-5-14-31(16-15-30)25-20-6-1-2-7-21(20)26-18-27-25/h1-2,6-7,9,11,18H,3-5,8,10,12-17H2,(H,28,29,32) |
| InChIKey | VJXCDVNVMXWJDN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|