C23H27N5O2S — CID 11676487
7-[4-(4-thieno[2,3-c]pyridin-7-ylpiperazin-1-yl)butoxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 11676487) has the molecular formula C23H27N5O2S and a molecular weight of 437.57 g/mol. Its IUPAC name is 7-[4-(4-thieno[2,3-c]pyridin-7-ylpiperazin-1-yl)butoxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 7-[4-(4-thieno[2,3-c]pyridin-7-ylpiperazin-1-yl)butoxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 11676487 |
| Molecular Formula | C23H27N5O2S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 7-[4-(4-thieno[2,3-c]pyridin-7-ylpiperazin-1-yl)butoxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | O=C1CCc2ccc(OCCCCN3CCN(c4nccc5ccsc45)CC3)nc2N1 |
| InChI | InChI=1S/C23H27N5O2S/c29-19-5-3-18-4-6-20(26-22(18)25-19)30-15-2-1-10-27-11-13-28(14-12-27)23-21-17(7-9-24-23)8-16-31-21/h4,6-9,16H,1-3,5,10-15H2,(H,25,26,29) |
| InChIKey | SWYRNMMIZQUDGW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|